About [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate
[(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate (PubChem CID 74945293) has the molecular formula C13H15NO4
and a molecular weight of 249.27 g/mol. Its IUPAC name is [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate.
Molecular Properties
| Compound Name | [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate |
| PubChem CID | 74945293 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate |
| SMILES | CC1=CC(=O)C(C(C)C)=CC1=NOC(=O)C1CO1 |
| InChI | InChI=1S/C13H15NO4/c1-7(2)9-5-10(8(3)4-11(9)15)14-18-13(16)12-6-17-12/h4-5,7,12H,6H2,1-3H3 |
| InChIKey | WDIMECWSGHGJBB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 68.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate?
The IUPAC name of [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate (CID 74945293) is [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate.
What is the SMILES notation for [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate?
The canonical SMILES for [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate is CC1=CC(=O)C(C(C)C)=CC1=NOC(=O)C1CO1.
What is the InChIKey of [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate?
The InChIKey is WDIMECWSGHGJBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c1-7(2)9-5-10(8(3)4-11(9)15)14-18-13(16)12-6-17-12/h4-5,7,12H,6H2,1-3H3.
What are the key properties of [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate?
[(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate has a molecular weight of 249.27 g/mol, XLogP of 1.40, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] oxirane-2-carboxylate is sourced from PubChem (CID 74945293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).