About [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate
[(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate (PubChem CID 74945571) has the molecular formula C14H17NO3
and a molecular weight of 247.29 g/mol. Its IUPAC name is [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate.
Molecular Properties
| Compound Name | [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate |
| PubChem CID | 74945571 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate |
| SMILES | CC1=CC(=O)C(C(C)C)=CC1=NOC(=O)C1CC1 |
| InChI | InChI=1S/C14H17NO3/c1-8(2)11-7-12(9(3)6-13(11)16)15-18-14(17)10-4-5-10/h6-8,10H,4-5H2,1-3H3 |
| InChIKey | RFUYKNRBIBCPSC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate?
The IUPAC name of [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate (CID 74945571) is [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate.
What is the SMILES notation for [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate?
The canonical SMILES for [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate is CC1=CC(=O)C(C(C)C)=CC1=NOC(=O)C1CC1.
What is the InChIKey of [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate?
The InChIKey is RFUYKNRBIBCPSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3/c1-8(2)11-7-12(9(3)6-13(11)16)15-18-14(17)10-4-5-10/h6-8,10H,4-5H2,1-3H3.
What are the key properties of [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate?
[(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate has a molecular weight of 247.29 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] cyclopropanecarboxylate is sourced from PubChem (CID 74945571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).