C20H21F6N5O2 — CID 74947053
7-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N,N-dimethyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxamide (PubChem CID 74947053) has the molecular formula C20H21F6N5O2 and a molecular weight of 477.41 g/mol. Its IUPAC name is 7-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N,N-dimethyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxamide.
| Compound Name | 7-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N,N-dimethyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxamide |
|---|---|
| PubChem CID | 74947053 |
| Molecular Formula | C20H21F6N5O2 |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 7-[3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-N,N-dimethyl-3-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-1-carboxamide |
| SMILES | CN(C)C(=O)c1nc(C(F)(F)F)n2c1CN(C(=O)CC(N)Cc1cc(F)c(F)cc1F)CC2 |
| InChI | InChI=1S/C20H21F6N5O2/c1-29(2)18(33)17-15-9-30(3-4-31(15)19(28-17)20(24,25)26)16(32)7-11(27)5-10-6-13(22)14(23)8-12(10)21/h6,8,11H,3-5,7,9,27H2,1-2H3 |
| InChIKey | DFIYQWYUBYZYEU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|