C10H14O4 — CID 74947856
6-(1,2-dihydroxypentyl)pyran-2-one (PubChem CID 74947856) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 6-(1,2-dihydroxypentyl)pyran-2-one.
| Compound Name | 6-(1,2-dihydroxypentyl)pyran-2-one |
|---|---|
| PubChem CID | 74947856 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 6-(1,2-dihydroxypentyl)pyran-2-one |
| SMILES | CCCC(O)C(O)c1cccc(=O)o1 |
| InChI | InChI=1S/C10H14O4/c1-2-4-7(11)10(13)8-5-3-6-9(12)14-8/h3,5-7,10-11,13H,2,4H2,1H3 |
| InChIKey | VPAQOCIIZZGSDX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |