About 1-ethoxy-4-nitrobenzene
1-ethoxy-4-nitrobenzene (PubChem CID 7495) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is 1-ethoxy-4-nitrobenzene.
Molecular Properties
| Compound Name | 1-ethoxy-4-nitrobenzene |
| PubChem CID | 7495 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 1-ethoxy-4-nitrobenzene |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H9NO3/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6H,2H2,1H3 |
| InChIKey | NWPKEYHUZKMWKJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxy-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-4-nitrobenzene?
The IUPAC name of 1-ethoxy-4-nitrobenzene (CID 7495) is 1-ethoxy-4-nitrobenzene.
What is the SMILES notation for 1-ethoxy-4-nitrobenzene?
The canonical SMILES for 1-ethoxy-4-nitrobenzene is CCOc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-ethoxy-4-nitrobenzene?
The InChIKey is NWPKEYHUZKMWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6H,2H2,1H3.
What are the key properties of 1-ethoxy-4-nitrobenzene?
1-ethoxy-4-nitrobenzene has a molecular weight of 167.16 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-4-nitrobenzene is sourced from PubChem (CID 7495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).