C14H25NO5 — CID 74950736
ditert-butyl 5-hydroxypyrrolidine-1,2-dicarboxylate (PubChem CID 74950736) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is ditert-butyl 5-hydroxypyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl 5-hydroxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 74950736 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | ditert-butyl 5-hydroxypyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCC(O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO5/c1-13(2,3)19-11(17)9-7-8-10(16)15(9)12(18)20-14(4,5)6/h9-10,16H,7-8H2,1-6H3 |
| InChIKey | YFGRKTBRNCLLIA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |