C36H51NO4 — CID 74950930
[5-(5,6-dimethylhept-3-en-2-yl)-13-hydroxy-6,10-dimethyl-17-oxa-16-azapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-18-en-16-yl]-(2-methoxyphenyl)methanone (PubChem CID 74950930) has the molecular formula C36H51NO4 and a molecular weight of 561.81 g/mol. Its IUPAC name is [5-(5,6-dimethylhept-3-en-2-yl)-13-hydroxy-6,10-dimethyl-17-oxa-16-azapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-18-en-16-yl]-(2-methoxyphenyl)methanone.
| Compound Name | [5-(5,6-dimethylhept-3-en-2-yl)-13-hydroxy-6,10-dimethyl-17-oxa-16-azapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-18-en-16-yl]-(2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 74950930 |
| Molecular Formula | C36H51NO4 |
| Molecular Weight | 561.81 g/mol |
| Exact Mass | 561.38 |
| IUPAC Name | [5-(5,6-dimethylhept-3-en-2-yl)-13-hydroxy-6,10-dimethyl-17-oxa-16-azapentacyclo[13.2.2.01,9.02,6.010,15]nonadec-18-en-16-yl]-(2-methoxyphenyl)methanone |
| SMILES | COc1ccccc1C(=O)N1OC23C=CC14CC(O)CCC4(C)C2CCC1(C)C(C(C)C=CC(C)C(C)C)CCC13 |
| InChI | InChI=1S/C36H51NO4/c1-23(2)24(3)12-13-25(4)28-14-15-30-33(28,5)18-17-31-34(6)19-16-26(38)22-35(34)20-21-36(30,31)41-37(35)32(39)27-10-8-9-11-29(27)40-7/h8-13,20-21,23-26,28,30-31,38H,14-19,22H2,1-7H3 |
| InChIKey | NWMFVXHLZXYTRG-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.81 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|