C35H40N4O2 — CID 74951953
N-[[3-(4-aminobutyl)-1-(naphthalen-2-ylmethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-2-(4-phenylphenyl)acetamide (PubChem CID 74951953) has the molecular formula C35H40N4O2 and a molecular weight of 548.73 g/mol. Its IUPAC name is N-[[3-(4-aminobutyl)-1-(naphthalen-2-ylmethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[[3-(4-aminobutyl)-1-(naphthalen-2-ylmethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 74951953 |
| Molecular Formula | C35H40N4O2 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | N-[[3-(4-aminobutyl)-1-(naphthalen-2-ylmethyl)-2-oxo-1,4-diazepan-5-yl]methyl]-2-(4-phenylphenyl)acetamide |
| SMILES | NCCCCC1NC(CNC(=O)Cc2ccc(-c3ccccc3)cc2)CCN(Cc2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C35H40N4O2/c36-20-7-6-12-33-35(41)39(25-27-15-18-29-10-4-5-11-31(29)22-27)21-19-32(38-33)24-37-34(40)23-26-13-16-30(17-14-26)28-8-2-1-3-9-28/h1-5,8-11,13-18,22,32-33,38H,6-7,12,19-21,23-25,36H2,(H,37,40) |
| InChIKey | MGRQBYLBMYEQPU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|