C27H28O6 — CID 74953485
3,5-dihydroxy-2,4,6-tris(phenylmethoxy)cyclohexan-1-one (PubChem CID 74953485) has the molecular formula C27H28O6 and a molecular weight of 448.51 g/mol. Its IUPAC name is 3,5-dihydroxy-2,4,6-tris(phenylmethoxy)cyclohexan-1-one.
| Compound Name | 3,5-dihydroxy-2,4,6-tris(phenylmethoxy)cyclohexan-1-one |
|---|---|
| PubChem CID | 74953485 |
| Molecular Formula | C27H28O6 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 3,5-dihydroxy-2,4,6-tris(phenylmethoxy)cyclohexan-1-one |
| SMILES | O=C1C(OCc2ccccc2)C(O)C(OCc2ccccc2)C(O)C1OCc1ccccc1 |
| InChI | InChI=1S/C27H28O6/c28-22-25(31-16-19-10-4-1-5-11-19)23(29)27(33-18-21-14-8-3-9-15-21)24(30)26(22)32-17-20-12-6-2-7-13-20/h1-15,22-23,25-29H,16-18H2 |
| InChIKey | XANDSGYCZAUHOH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |