C22H10F17NO3S — CID 74953520
[[1-(9H-fluoren-2-yl)-2,2,3,3,4,4,5,5-octafluoropentylidene]amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 74953520) has the molecular formula C22H10F17NO3S and a molecular weight of 691.36 g/mol. Its IUPAC name is [[1-(9H-fluoren-2-yl)-2,2,3,3,4,4,5,5-octafluoropentylidene]amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [[1-(9H-fluoren-2-yl)-2,2,3,3,4,4,5,5-octafluoropentylidene]amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 74953520 |
| Molecular Formula | C22H10F17NO3S |
| Molecular Weight | 691.36 g/mol |
| Exact Mass | 691.01 |
| IUPAC Name | [[1-(9H-fluoren-2-yl)-2,2,3,3,4,4,5,5-octafluoropentylidene]amino] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(ON=C(c1ccc2c(c1)Cc1ccccc1-2)C(F)(F)C(F)(F)C(F)(F)C(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H10F17NO3S/c23-15(24)17(27,28)18(29,30)16(25,26)14(10-5-6-13-11(8-10)7-9-3-1-2-4-12(9)13)40-43-44(41,42)22(38,39)20(33,34)19(31,32)21(35,36)37/h1-6,8,15H,7H2 |
| InChIKey | PMYQUTMCFSBEMT-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.36 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|