C27H24FN3O3 — CID 74953970
2-[2-(2-cyclopentyloxy-3-methoxyphenyl)ethenyl]-3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 74953970) has the molecular formula C27H24FN3O3 and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-[2-(2-cyclopentyloxy-3-methoxyphenyl)ethenyl]-3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[2-(2-cyclopentyloxy-3-methoxyphenyl)ethenyl]-3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 74953970 |
| Molecular Formula | C27H24FN3O3 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 2-[2-(2-cyclopentyloxy-3-methoxyphenyl)ethenyl]-3-(6-fluoro-3-pyridinyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | COc1cccc(C=Cc2nc3ccccn3c(=O)c2-c2ccc(F)nc2)c1OC1CCCC1 |
| InChI | InChI=1S/C27H24FN3O3/c1-33-22-10-6-7-18(26(22)34-20-8-2-3-9-20)12-14-21-25(19-13-15-23(28)29-17-19)27(32)31-16-5-4-11-24(31)30-21/h4-7,10-17,20H,2-3,8-9H2,1H3 |
| InChIKey | LVPFJQXNTYWMJG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|