C13H22F3NO2 — CID 74955410
3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butanoic acid (PubChem CID 74955410) has the molecular formula C13H22F3NO2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butanoic acid.
| Compound Name | 3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 74955410 |
| Molecular Formula | C13H22F3NO2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3-methyl-2-(1,1,1-trifluorooct-7-en-2-ylamino)butanoic acid |
| SMILES | C=CCCCCC(NC(C(=O)O)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H22F3NO2/c1-4-5-6-7-8-10(13(14,15)16)17-11(9(2)3)12(18)19/h4,9-11,17H,1,5-8H2,2-3H3,(H,18,19) |
| InChIKey | KPNSJZHOJZHDKV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|