About 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene
3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene (PubChem CID 74955564) has the molecular formula C27H23O3P
and a molecular weight of 426.45 g/mol. Its IUPAC name is 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene.
Molecular Properties
| Compound Name | 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene |
| PubChem CID | 74955564 |
| Molecular Formula | C27H23O3P |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)C1=C(c2ccccc2)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C27H23O3P/c28-31(29-22-12-6-2-7-13-22,30-23-14-8-3-9-15-23)27-25(19-10-4-1-5-11-19)24-20-16-17-21(18-20)26(24)27/h1-17,20-21,24,26H,18H2 |
| InChIKey | GXZPQHKFOHBDKB-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene?
The IUPAC name of 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene (CID 74955564) is 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene.
What is the SMILES notation for 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene?
The canonical SMILES for 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene is O=P(Oc1ccccc1)(Oc1ccccc1)C1=C(c2ccccc2)C2C3C=CC(C3)C12.
What is the InChIKey of 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene?
The InChIKey is GXZPQHKFOHBDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23O3P/c28-31(29-22-12-6-2-7-13-22,30-23-14-8-3-9-15-23)27-25(19-10-4-1-5-11-19)24-20-16-17-21(18-20)26(24)27/h1-17,20-21,24,26H,18H2.
What are the key properties of 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene?
3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene has a molecular weight of 426.45 g/mol, XLogP of 7.20, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diphenoxyphosphoryl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene is sourced from PubChem (CID 74955564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).