About 4-methylocta-2,4,6-trienedial
4-methylocta-2,4,6-trienedial (PubChem CID 74956406) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 4-methylocta-2,4,6-trienedial.
Molecular Properties
| Compound Name | 4-methylocta-2,4,6-trienedial |
| PubChem CID | 74956406 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 4-methylocta-2,4,6-trienedial |
| SMILES | CC(C=CC=O)=CC=CC=O |
| InChI | InChI=1S/C9H10O2/c1-9(6-4-8-11)5-2-3-7-10/h2-8H,1H3 |
| InChIKey | HLZZDTVXNYNFKH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylocta-2,4,6-trienedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylocta-2,4,6-trienedial?
The IUPAC name of 4-methylocta-2,4,6-trienedial (CID 74956406) is 4-methylocta-2,4,6-trienedial.
What is the SMILES notation for 4-methylocta-2,4,6-trienedial?
The canonical SMILES for 4-methylocta-2,4,6-trienedial is CC(C=CC=O)=CC=CC=O.
What is the InChIKey of 4-methylocta-2,4,6-trienedial?
The InChIKey is HLZZDTVXNYNFKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-9(6-4-8-11)5-2-3-7-10/h2-8H,1H3.
What are the key properties of 4-methylocta-2,4,6-trienedial?
4-methylocta-2,4,6-trienedial has a molecular weight of 150.18 g/mol, XLogP of 1.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylocta-2,4,6-trienedial is sourced from PubChem (CID 74956406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).