C30H36F2N4O2 — CID 74958327
4-[4-(4,4-difluoropiperidin-1-yl)phenyl]-N-(5-hydroxy-2-adamantyl)-2,3-dihydroquinoxaline-1-carboxamide (PubChem CID 74958327) has the molecular formula C30H36F2N4O2 and a molecular weight of 522.64 g/mol. Its IUPAC name is 4-[4-(4,4-difluoropiperidin-1-yl)phenyl]-N-(5-hydroxy-2-adamantyl)-2,3-dihydroquinoxaline-1-carboxamide.
| Compound Name | 4-[4-(4,4-difluoropiperidin-1-yl)phenyl]-N-(5-hydroxy-2-adamantyl)-2,3-dihydroquinoxaline-1-carboxamide |
|---|---|
| PubChem CID | 74958327 |
| Molecular Formula | C30H36F2N4O2 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | 4-[4-(4,4-difluoropiperidin-1-yl)phenyl]-N-(5-hydroxy-2-adamantyl)-2,3-dihydroquinoxaline-1-carboxamide |
| SMILES | O=C(NC1C2CC3CC1CC(O)(C3)C2)N1CCN(c2ccc(N3CCC(F)(F)CC3)cc2)c2ccccc21 |
| InChI | InChI=1S/C30H36F2N4O2/c31-30(32)9-11-34(12-10-30)23-5-7-24(8-6-23)35-13-14-36(26-4-2-1-3-25(26)35)28(37)33-27-21-15-20-16-22(27)19-29(38,17-20)18-21/h1-8,20-22,27,38H,9-19H2,(H,33,37) |
| InChIKey | VYOBIJUUSCEVCY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|