C20H34O2 — CID 74960055
2-(1,5,9-trimethyl-4-oxatricyclo[10.3.0.03,5]pentadec-8-en-13-yl)propan-2-ol (PubChem CID 74960055) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 2-(1,5,9-trimethyl-4-oxatricyclo[10.3.0.03,5]pentadec-8-en-13-yl)propan-2-ol.
| Compound Name | 2-(1,5,9-trimethyl-4-oxatricyclo[10.3.0.03,5]pentadec-8-en-13-yl)propan-2-ol |
|---|---|
| PubChem CID | 74960055 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 2-(1,5,9-trimethyl-4-oxatricyclo[10.3.0.03,5]pentadec-8-en-13-yl)propan-2-ol |
| SMILES | CC1=CCCC2(C)OC2CC2(C)CCC(C(C)(C)O)C2CC1 |
| InChI | InChI=1S/C20H34O2/c1-14-7-6-11-20(5)17(22-20)13-19(4)12-10-15(18(2,3)21)16(19)9-8-14/h7,15-17,21H,6,8-13H2,1-5H3 |
| InChIKey | YAAAQPPNZGJCNT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|