C35H43N5O5S — CID 74960705
6-(2-aminobutanoylamino)-N-benzhydryl-7-[[(4-methylphenyl)sulfonylamino]methyl]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide (PubChem CID 74960705) has the molecular formula C35H43N5O5S and a molecular weight of 645.83 g/mol. Its IUPAC name is 6-(2-aminobutanoylamino)-N-benzhydryl-7-[[(4-methylphenyl)sulfonylamino]methyl]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide.
| Compound Name | 6-(2-aminobutanoylamino)-N-benzhydryl-7-[[(4-methylphenyl)sulfonylamino]methyl]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide |
|---|---|
| PubChem CID | 74960705 |
| Molecular Formula | C35H43N5O5S |
| Molecular Weight | 645.83 g/mol |
| Exact Mass | 645.30 |
| IUPAC Name | 6-(2-aminobutanoylamino)-N-benzhydryl-7-[[(4-methylphenyl)sulfonylamino]methyl]-5-oxo-1,2,3,6,7,8,9,9a-octahydropyrrolo[1,2-a]azepine-3-carboxamide |
| SMILES | CCC(N)C(=O)NC1C(=O)N2C(CCC1CNS(=O)(=O)c1ccc(C)cc1)CCC2C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H43N5O5S/c1-3-29(36)33(41)39-32-26(22-37-46(44,45)28-19-14-23(2)15-20-28)16-17-27-18-21-30(40(27)35(32)43)34(42)38-31(24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-15,19-20,26-27,29-32,37H,3,16-18,21-22,36H2,1-2H3,(H,38,42)(H,39,41) |
| InChIKey | VMODNEWYLILSMS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |