C18H19N5O2S — CID 74964286
N'-(3-cyano-4-methyl-5,6,7,8-tetrahydroquinolin-2-yl)-N-(4-sulfamoylphenyl)methanimidamide (PubChem CID 74964286) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is N'-(3-cyano-4-methyl-5,6,7,8-tetrahydroquinolin-2-yl)-N-(4-sulfamoylphenyl)methanimidamide.
| Compound Name | N'-(3-cyano-4-methyl-5,6,7,8-tetrahydroquinolin-2-yl)-N-(4-sulfamoylphenyl)methanimidamide |
|---|---|
| PubChem CID | 74964286 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N'-(3-cyano-4-methyl-5,6,7,8-tetrahydroquinolin-2-yl)-N-(4-sulfamoylphenyl)methanimidamide |
| SMILES | Cc1c(C#N)c(N=CNc2ccc(S(N)(=O)=O)cc2)nc2c1CCCC2 |
| InChI | InChI=1S/C18H19N5O2S/c1-12-15-4-2-3-5-17(15)23-18(16(12)10-19)22-11-21-13-6-8-14(9-7-13)26(20,24)25/h6-9,11H,2-5H2,1H3,(H2,20,24,25)(H,21,22,23) |
| InChIKey | VCHJXXVIECKJRH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|