C17H22N6O2 — CID 749680
4,6-dimorpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine (PubChem CID 749680) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4,6-dimorpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dimorpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 749680 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4,6-dimorpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine |
| SMILES | c1ccc(Nc2nc(N3CCOCC3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C17H22N6O2/c1-2-4-14(5-3-1)18-15-19-16(22-6-10-24-11-7-22)21-17(20-15)23-8-12-25-13-9-23/h1-5H,6-13H2,(H,18,19,20,21) |
| InChIKey | MKAUGKLCEXBZIA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |