About 2-(diethylamino)ethanol
2-(diethylamino)ethanol (PubChem CID 7497) has the molecular formula C6H15NO
and a molecular weight of 117.19 g/mol. Its IUPAC name is 2-(diethylamino)ethanol.
Molecular Properties
| Compound Name | 2-(diethylamino)ethanol |
| PubChem CID | 7497 |
| Molecular Formula | C6H15NO |
| Molecular Weight | 117.19 g/mol |
| Exact Mass | 117.12 |
| IUPAC Name | 2-(diethylamino)ethanol |
| SMILES | CCN(CC)CCO |
| InChI | InChI=1S/C6H15NO/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3 |
| InChIKey | BFSVOASYOCHEOV-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.19 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(diethylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethanol?
The IUPAC name of 2-(diethylamino)ethanol (CID 7497) is 2-(diethylamino)ethanol.
What is the SMILES notation for 2-(diethylamino)ethanol?
The canonical SMILES for 2-(diethylamino)ethanol is CCN(CC)CCO.
What is the InChIKey of 2-(diethylamino)ethanol?
The InChIKey is BFSVOASYOCHEOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3.
What are the key properties of 2-(diethylamino)ethanol?
2-(diethylamino)ethanol has a molecular weight of 117.19 g/mol, XLogP of 0.32, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethanol is sourced from PubChem (CID 7497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).