C23H27FN6O3 — CID 74975100
1-(4-fluorophenyl)-N-[5-methyl-6-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]oxypyrimidin-4-yl]oxyethanimine (PubChem CID 74975100) has the molecular formula C23H27FN6O3 and a molecular weight of 454.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[5-methyl-6-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]oxypyrimidin-4-yl]oxyethanimine.
| Compound Name | 1-(4-fluorophenyl)-N-[5-methyl-6-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]oxypyrimidin-4-yl]oxyethanimine |
|---|---|
| PubChem CID | 74975100 |
| Molecular Formula | C23H27FN6O3 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[5-methyl-6-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]oxypyrimidin-4-yl]oxyethanimine |
| SMILES | CC(=NOc1ncnc(OC2CCN(c3nc(C(C)C)no3)CC2)c1C)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H27FN6O3/c1-14(2)20-27-23(33-29-20)30-11-9-19(10-12-30)31-21-15(3)22(26-13-25-21)32-28-16(4)17-5-7-18(24)8-6-17/h5-8,13-14,19H,9-12H2,1-4H3 |
| InChIKey | WHEBNTLBBSRJAJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 98.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|