C18H16O6 — CID 74977213
14-methoxy-6,8,12,21-tetraoxapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-2(10),3,5(9),15(20),16,18-hexaen-18-ol (PubChem CID 74977213) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is 14-methoxy-6,8,12,21-tetraoxapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-2(10),3,5(9),15(20),16,18-hexaen-18-ol.
| Compound Name | 14-methoxy-6,8,12,21-tetraoxapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-2(10),3,5(9),15(20),16,18-hexaen-18-ol |
|---|---|
| PubChem CID | 74977213 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 14-methoxy-6,8,12,21-tetraoxapentacyclo[11.8.0.02,10.05,9.015,20]henicosa-2(10),3,5(9),15(20),16,18-hexaen-18-ol |
| SMILES | COC1c2ccc(O)cc2OC2c3ccc4c(c3COC12)OCO4 |
| InChI | InChI=1S/C18H16O6/c1-20-16-11-3-2-9(19)6-14(11)24-17-10-4-5-13-15(23-8-22-13)12(10)7-21-18(16)17/h2-6,16-19H,7-8H2,1H3 |
| InChIKey | UCGKJWSJSJGUBQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |