About (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate
(7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate (PubChem CID 749790) has the molecular formula C17H13ClN2O2
and a molecular weight of 312.76 g/mol. Its IUPAC name is (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate.
Molecular Properties
| Compound Name | (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate |
| PubChem CID | 749790 |
| Molecular Formula | C17H13ClN2O2 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate |
| SMILES | CN(C(=O)Oc1ccnc2cc(Cl)ccc12)c1ccccc1 |
| InChI | InChI=1S/C17H13ClN2O2/c1-20(13-5-3-2-4-6-13)17(21)22-16-9-10-19-15-11-12(18)7-8-14(15)16/h2-11H,1H3 |
| InChIKey | MCPSAWKMMXHAAK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate?
The IUPAC name of (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate (CID 749790) is (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate.
What is the SMILES notation for (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate?
The canonical SMILES for (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate is CN(C(=O)Oc1ccnc2cc(Cl)ccc12)c1ccccc1.
What is the InChIKey of (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate?
The InChIKey is MCPSAWKMMXHAAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN2O2/c1-20(13-5-3-2-4-6-13)17(21)22-16-9-10-19-15-11-12(18)7-8-14(15)16/h2-11H,1H3.
What are the key properties of (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate?
(7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate has a molecular weight of 312.76 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloroquinolin-4-yl) N-methyl-N-phenylcarbamate is sourced from PubChem (CID 749790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).