C20H29N3O2S — CID 7497942
N-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-2-phenylethanesulfonamide (PubChem CID 7497942) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is N-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-2-phenylethanesulfonamide.
| Compound Name | N-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 7497942 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-[(2S)-2-(dimethylamino)-2-[4-(dimethylamino)phenyl]ethyl]-2-phenylethanesulfonamide |
| SMILES | CN(C)c1ccc([C@@H](CNS(=O)(=O)CCc2ccccc2)N(C)C)cc1 |
| InChI | InChI=1S/C20H29N3O2S/c1-22(2)19-12-10-18(11-13-19)20(23(3)4)16-21-26(24,25)15-14-17-8-6-5-7-9-17/h5-13,20-21H,14-16H2,1-4H3/t20-/m1/s1 |
| InChIKey | RIPUKUYEVURKJZ-HXUWFJFHSA-N |
| XLogP | 2.52 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|