About 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one
6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one (PubChem CID 749816) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one.
Molecular Properties
| Compound Name | 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one |
| PubChem CID | 749816 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one |
| SMILES | CCCc1noc2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C12H17NO2/c1-4-5-8-11-9(14)6-12(2,3)7-10(11)15-13-8/h4-7H2,1-3H3 |
| InChIKey | HKZFVBRFMCRFDC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one?
The IUPAC name of 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one (CID 749816) is 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one.
What is the SMILES notation for 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one?
The canonical SMILES for 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one is CCCc1noc2c1C(=O)CC(C)(C)C2.
What is the InChIKey of 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one?
The InChIKey is HKZFVBRFMCRFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-4-5-8-11-9(14)6-12(2,3)7-10(11)15-13-8/h4-7H2,1-3H3.
What are the key properties of 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one?
6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one has a molecular weight of 207.27 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-3-propyl-5,7-dihydro-1,2-benzoxazol-4-one is sourced from PubChem (CID 749816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).