C16H27N3O3S — CID 7498187
N-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]ethanesulfonamide (PubChem CID 7498187) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is N-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]ethanesulfonamide.
| Compound Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 7498187 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[(2R)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC[C@@H](c1ccc(N(C)C)cc1)N1CCOCC1 |
| InChI | InChI=1S/C16H27N3O3S/c1-4-23(20,21)17-13-16(19-9-11-22-12-10-19)14-5-7-15(8-6-14)18(2)3/h5-8,16-17H,4,9-13H2,1-3H3/t16-/m0/s1 |
| InChIKey | JXMHYCYLGLYOKM-INIZCTEOSA-N |
| XLogP | 1.07 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|