C26H25FN2O4 — CID 74982220
2-[[4-(3-fluorophenyl)phenyl]methyl]-N'-hydroxy-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)butanediamide (PubChem CID 74982220) has the molecular formula C26H25FN2O4 and a molecular weight of 448.49 g/mol. Its IUPAC name is 2-[[4-(3-fluorophenyl)phenyl]methyl]-N'-hydroxy-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)butanediamide.
| Compound Name | 2-[[4-(3-fluorophenyl)phenyl]methyl]-N'-hydroxy-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)butanediamide |
|---|---|
| PubChem CID | 74982220 |
| Molecular Formula | C26H25FN2O4 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-[[4-(3-fluorophenyl)phenyl]methyl]-N'-hydroxy-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)butanediamide |
| SMILES | O=C(CC(Cc1ccc(-c2cccc(F)c2)cc1)C(=O)NC1c2ccccc2CC1O)NO |
| InChI | InChI=1S/C26H25FN2O4/c27-21-6-3-5-18(13-21)17-10-8-16(9-11-17)12-20(15-24(31)29-33)26(32)28-25-22-7-2-1-4-19(22)14-23(25)30/h1-11,13,20,23,25,30,33H,12,14-15H2,(H,28,32)(H,29,31) |
| InChIKey | KLPLOGXKUWGLSE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|