About [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate
[(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate (PubChem CID 74982234) has the molecular formula C25H36O3Si
and a molecular weight of 412.65 g/mol. Its IUPAC name is [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate.
Molecular Properties
| Compound Name | [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate |
| PubChem CID | 74982234 |
| Molecular Formula | C25H36O3Si |
| Molecular Weight | 412.65 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate |
| SMILES | CC(=O)OC[C@@H](C)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36O3Si/c1-20(18-27-22(3)26)17-21(2)19-28-29(25(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,20-21H,17-19H2,1-6H3/t20-,21+/m0/s1 |
| InChIKey | NBNJBTGOTUWUQY-LEWJYISDSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate?
The IUPAC name of [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate (CID 74982234) is [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate.
What is the SMILES notation for [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate?
The canonical SMILES for [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate is CC(=O)OC[C@@H](C)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate?
The InChIKey is NBNJBTGOTUWUQY-LEWJYISDSA-N. The full InChI is InChI=1S/C25H36O3Si/c1-20(18-27-22(3)26)17-21(2)19-28-29(25(4,5)6,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,20-21H,17-19H2,1-6H3/t20-,21+/m0/s1.
What are the key properties of [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate?
[(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate has a molecular weight of 412.65 g/mol, XLogP of 4.79, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] acetate is sourced from PubChem (CID 74982234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).