C30H47NO3Si — CID 74982242
[(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] N,N-di(propan-2-yl)carbamate (PubChem CID 74982242) has the molecular formula C30H47NO3Si and a molecular weight of 497.80 g/mol. Its IUPAC name is [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 74982242 |
| Molecular Formula | C30H47NO3Si |
| Molecular Weight | 497.80 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | [(2S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-2,4-dimethylpentyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)OC[C@@H](C)C[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C30H47NO3Si/c1-23(2)31(24(3)4)29(32)33-21-25(5)20-26(6)22-34-35(30(7,8)9,27-16-12-10-13-17-27)28-18-14-11-15-19-28/h10-19,23-26H,20-22H2,1-9H3/t25-,26+/m0/s1 |
| InChIKey | RJDUPJMZGKDZBU-IZZNHLLZSA-N |
| XLogP | 6.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.80 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|