About 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one
1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one (PubChem CID 749823) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one.
Molecular Properties
| Compound Name | 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one |
| PubChem CID | 749823 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one |
| SMILES | CC(=O)n1nc(C)c2c1CC(C)(C)CC2=O |
| InChI | InChI=1S/C12H16N2O2/c1-7-11-9(14(13-7)8(2)15)5-12(3,4)6-10(11)16/h5-6H2,1-4H3 |
| InChIKey | SCMJXYGEGGJBTD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one?
The IUPAC name of 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one (CID 749823) is 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one.
What is the SMILES notation for 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one?
The canonical SMILES for 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one is CC(=O)n1nc(C)c2c1CC(C)(C)CC2=O.
What is the InChIKey of 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one?
The InChIKey is SCMJXYGEGGJBTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-7-11-9(14(13-7)8(2)15)5-12(3,4)6-10(11)16/h5-6H2,1-4H3.
What are the key properties of 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one?
1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one has a molecular weight of 220.27 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-3,6,6-trimethyl-5,7-dihydroindazol-4-one is sourced from PubChem (CID 749823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).