About 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide
4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 74982356) has the molecular formula C19H19N7O2S
and a molecular weight of 409.48 g/mol. Its IUPAC name is 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide |
| PubChem CID | 74982356 |
| Molecular Formula | C19H19N7O2S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | Cc1c2ccc(Nc3ccnc(Nc4ccc(S(N)(=O)=O)cc4)n3)cc2nn1C |
| InChI | InChI=1S/C19H19N7O2S/c1-12-16-8-5-14(11-17(16)25-26(12)2)22-18-9-10-21-19(24-18)23-13-3-6-15(7-4-13)29(20,27)28/h3-11H,1-2H3,(H2,20,27,28)(H2,21,22,23,24) |
| InChIKey | WRJUIWPLARWCGQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide?
The IUPAC name of 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide (CID 74982356) is 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide.
What is the SMILES notation for 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide?
The canonical SMILES for 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide is Cc1c2ccc(Nc3ccnc(Nc4ccc(S(N)(=O)=O)cc4)n3)cc2nn1C.
What is the InChIKey of 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide?
The InChIKey is WRJUIWPLARWCGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N7O2S/c1-12-16-8-5-14(11-17(16)25-26(12)2)22-18-9-10-21-19(24-18)23-13-3-6-15(7-4-13)29(20,27)28/h3-11H,1-2H3,(H2,20,27,28)(H2,21,22,23,24).
What are the key properties of 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide?
4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide has a molecular weight of 409.48 g/mol, XLogP of 2.81, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[(2,3-dimethylindazol-6-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide is sourced from PubChem (CID 74982356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).