C27H26N8O2S — CID 74982726
N-[6-[4-[5-[[2-(1H-indazol-4-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-phenylacetamide (PubChem CID 74982726) has the molecular formula C27H26N8O2S and a molecular weight of 526.63 g/mol. Its IUPAC name is N-[6-[4-[5-[[2-(1H-indazol-4-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-phenylacetamide.
| Compound Name | N-[6-[4-[5-[[2-(1H-indazol-4-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 74982726 |
| Molecular Formula | C27H26N8O2S |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | N-[6-[4-[5-[[2-(1H-indazol-4-yl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(CCCCc2nnc(NC(=O)Cc3cccc4[nH]ncc34)s2)nn1 |
| InChI | InChI=1S/C27H26N8O2S/c36-24(15-18-7-2-1-3-8-18)29-23-14-13-20(31-33-23)10-4-5-12-26-34-35-27(38-26)30-25(37)16-19-9-6-11-22-21(19)17-28-32-22/h1-3,6-9,11,13-14,17H,4-5,10,12,15-16H2,(H,28,32)(H,29,33,36)(H,30,35,37) |
| InChIKey | SBOZXBOCOWCXFH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|