C27H25F3N6O3S — CID 74982788
2-phenyl-N-[5-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 74982788) has the molecular formula C27H25F3N6O3S and a molecular weight of 570.60 g/mol. Its IUPAC name is 2-phenyl-N-[5-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-phenyl-N-[5-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 74982788 |
| Molecular Formula | C27H25F3N6O3S |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 2-phenyl-N-[5-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Cc1cccc(OC(F)(F)F)c1)Nc1ccc(CCCCc2nnc(NC(=O)Cc3ccccc3)s2)nn1 |
| InChI | InChI=1S/C27H25F3N6O3S/c28-27(29,30)39-21-11-6-9-19(15-21)17-23(37)31-22-14-13-20(33-34-22)10-4-5-12-25-35-36-26(40-25)32-24(38)16-18-7-2-1-3-8-18/h1-3,6-9,11,13-15H,4-5,10,12,16-17H2,(H,31,34,37)(H,32,36,38) |
| InChIKey | UGUWNXBXJVUOOD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|