C27H26F2N6O3S — CID 74982833
N-[6-[4-[5-[[2-[3-(difluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-phenylacetamide (PubChem CID 74982833) has the molecular formula C27H26F2N6O3S and a molecular weight of 552.61 g/mol. Its IUPAC name is N-[6-[4-[5-[[2-[3-(difluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-phenylacetamide.
| Compound Name | N-[6-[4-[5-[[2-[3-(difluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 74982833 |
| Molecular Formula | C27H26F2N6O3S |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | N-[6-[4-[5-[[2-[3-(difluoromethoxy)phenyl]acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(CCCCc2nnc(NC(=O)Cc3cccc(OC(F)F)c3)s2)nn1 |
| InChI | InChI=1S/C27H26F2N6O3S/c28-26(29)38-21-11-6-9-19(15-21)17-24(37)31-27-35-34-25(39-27)12-5-4-10-20-13-14-22(33-32-20)30-23(36)16-18-7-2-1-3-8-18/h1-3,6-9,11,13-15,26H,4-5,10,12,16-17H2,(H,30,33,36)(H,31,35,37) |
| InChIKey | BAGOJANZLGJDHR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|