C16H17F3N4O2S — CID 74982874
N-butan-2-yl-5-[2-(2-methyl-1,3-thiazol-3-ium-4-yl)ethynyl]pyrimidin-2-amine;2,2,2-trifluoroacetate (PubChem CID 74982874) has the molecular formula C16H17F3N4O2S and a molecular weight of 386.40 g/mol. Its IUPAC name is N-butan-2-yl-5-[2-(2-methyl-1,3-thiazol-3-ium-4-yl)ethynyl]pyrimidin-2-amine;2,2,2-trifluoroacetate.
| Compound Name | N-butan-2-yl-5-[2-(2-methyl-1,3-thiazol-3-ium-4-yl)ethynyl]pyrimidin-2-amine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 74982874 |
| Molecular Formula | C16H17F3N4O2S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-butan-2-yl-5-[2-(2-methyl-1,3-thiazol-3-ium-4-yl)ethynyl]pyrimidin-2-amine;2,2,2-trifluoroacetate |
| SMILES | CCC(C)Nc1ncc(C#Cc2csc(C)[nH+]2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C14H16N4S.C2HF3O2/c1-4-10(2)17-14-15-7-12(8-16-14)5-6-13-9-19-11(3)18-13;3-2(4,5)1(6)7/h7-10H,4H2,1-3H3,(H,15,16,17);(H,6,7) |
| InChIKey | DJFGVVOUZKAZTJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|