C16H15F3N4O2S2 — CID 74982879
4-[5-[2-(2-methyl-1,3-thiazol-3-ium-4-yl)ethynyl]pyrimidin-2-yl]thiomorpholine;2,2,2-trifluoroacetate (PubChem CID 74982879) has the molecular formula C16H15F3N4O2S2 and a molecular weight of 416.45 g/mol. Its IUPAC name is 4-[5-[2-(2-methyl-1,3-thiazol-3-ium-4-yl)ethynyl]pyrimidin-2-yl]thiomorpholine;2,2,2-trifluoroacetate.
| Compound Name | 4-[5-[2-(2-methyl-1,3-thiazol-3-ium-4-yl)ethynyl]pyrimidin-2-yl]thiomorpholine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 74982879 |
| Molecular Formula | C16H15F3N4O2S2 |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 4-[5-[2-(2-methyl-1,3-thiazol-3-ium-4-yl)ethynyl]pyrimidin-2-yl]thiomorpholine;2,2,2-trifluoroacetate |
| SMILES | Cc1[nH+]c(C#Cc2cnc(N3CCSCC3)nc2)cs1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C14H14N4S2.C2HF3O2/c1-11-17-13(10-20-11)3-2-12-8-15-14(16-9-12)18-4-6-19-7-5-18;3-2(4,5)1(6)7/h8-10H,4-7H2,1H3;(H,6,7) |
| InChIKey | HAOQWGIKTYPVPK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|