C17H17F3N4O2S — CID 74982880
N-cyclopentyl-5-[2-(2-methyl-1,3-thiazol-3-ium-4-yl)ethynyl]pyrimidin-2-amine;2,2,2-trifluoroacetate (PubChem CID 74982880) has the molecular formula C17H17F3N4O2S and a molecular weight of 398.41 g/mol. Its IUPAC name is N-cyclopentyl-5-[2-(2-methyl-1,3-thiazol-3-ium-4-yl)ethynyl]pyrimidin-2-amine;2,2,2-trifluoroacetate.
| Compound Name | N-cyclopentyl-5-[2-(2-methyl-1,3-thiazol-3-ium-4-yl)ethynyl]pyrimidin-2-amine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 74982880 |
| Molecular Formula | C17H17F3N4O2S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-cyclopentyl-5-[2-(2-methyl-1,3-thiazol-3-ium-4-yl)ethynyl]pyrimidin-2-amine;2,2,2-trifluoroacetate |
| SMILES | Cc1[nH+]c(C#Cc2cnc(NC3CCCC3)nc2)cs1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C15H16N4S.C2HF3O2/c1-11-18-14(10-20-11)7-6-12-8-16-15(17-9-12)19-13-4-2-3-5-13;3-2(4,5)1(6)7/h8-10,13H,2-5H2,1H3,(H,16,17,19);(H,6,7) |
| InChIKey | BHXMFDUCRYMIKD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|