C18H19F3N4O2S — CID 74982881
2-methyl-4-[2-[2-(3-methylpiperidin-1-yl)pyrimidin-5-yl]ethynyl]-1,3-thiazol-3-ium;2,2,2-trifluoroacetate (PubChem CID 74982881) has the molecular formula C18H19F3N4O2S and a molecular weight of 412.44 g/mol. Its IUPAC name is 2-methyl-4-[2-[2-(3-methylpiperidin-1-yl)pyrimidin-5-yl]ethynyl]-1,3-thiazol-3-ium;2,2,2-trifluoroacetate.
| Compound Name | 2-methyl-4-[2-[2-(3-methylpiperidin-1-yl)pyrimidin-5-yl]ethynyl]-1,3-thiazol-3-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 74982881 |
| Molecular Formula | C18H19F3N4O2S |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-methyl-4-[2-[2-(3-methylpiperidin-1-yl)pyrimidin-5-yl]ethynyl]-1,3-thiazol-3-ium;2,2,2-trifluoroacetate |
| SMILES | Cc1[nH+]c(C#Cc2cnc(N3CCCC(C)C3)nc2)cs1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C16H18N4S.C2HF3O2/c1-12-4-3-7-20(10-12)16-17-8-14(9-18-16)5-6-15-11-21-13(2)19-15;3-2(4,5)1(6)7/h8-9,11-12H,3-4,7,10H2,1-2H3;(H,6,7) |
| InChIKey | MQFCAPHWUZTIDR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|