C18H22N4O3 — CID 74983105
1,3,7-triethyl-8-(phenoxymethyl)purine-2,6-dione (PubChem CID 74983105) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1,3,7-triethyl-8-(phenoxymethyl)purine-2,6-dione.
| Compound Name | 1,3,7-triethyl-8-(phenoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 74983105 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1,3,7-triethyl-8-(phenoxymethyl)purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(COc3ccccc3)n2CC)n(CC)c1=O |
| InChI | InChI=1S/C18H22N4O3/c1-4-20-14(12-25-13-10-8-7-9-11-13)19-16-15(20)17(23)22(6-3)18(24)21(16)5-2/h7-11H,4-6,12H2,1-3H3 |
| InChIKey | ODWDXVCOMQAWIP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |