About (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide
(2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide (PubChem CID 74983349) has the molecular formula C10H10FNO2
and a molecular weight of 195.19 g/mol. Its IUPAC name is (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide.
Molecular Properties
| Compound Name | (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide |
| PubChem CID | 74983349 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide |
| SMILES | C[C@@H]1Cc2cc(F)cc(C(N)=O)c2O1 |
| InChI | InChI=1S/C10H10FNO2/c1-5-2-6-3-7(11)4-8(10(12)13)9(6)14-5/h3-5H,2H2,1H3,(H2,12,13)/t5-/m1/s1 |
| InChIKey | ZPHKBVTUIABAIO-RXMQYKEDSA-N |
| XLogP | 1.25 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide?
The IUPAC name of (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide (CID 74983349) is (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide.
What is the SMILES notation for (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide?
The canonical SMILES for (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide is C[C@@H]1Cc2cc(F)cc(C(N)=O)c2O1.
What is the InChIKey of (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide?
The InChIKey is ZPHKBVTUIABAIO-RXMQYKEDSA-N. The full InChI is InChI=1S/C10H10FNO2/c1-5-2-6-3-7(11)4-8(10(12)13)9(6)14-5/h3-5H,2H2,1H3,(H2,12,13)/t5-/m1/s1.
What are the key properties of (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide?
(2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide has a molecular weight of 195.19 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-fluoro-2-methyl-2,3-dihydro-1-benzofuran-7-carboxamide is sourced from PubChem (CID 74983349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).