C25H30N2O3 — CID 7499593
(3S,3aR,6aS)-3-[(3R)-heptan-3-yl]-5-(4-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 7499593) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is (3S,3aR,6aS)-3-[(3R)-heptan-3-yl]-5-(4-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3S,3aR,6aS)-3-[(3R)-heptan-3-yl]-5-(4-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 7499593 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (3S,3aR,6aS)-3-[(3R)-heptan-3-yl]-5-(4-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCCC[C@@H](CC)[C@H]1[C@H]2C(=O)N(c3ccc(C)cc3)C(=O)[C@H]2ON1c1ccccc1 |
| InChI | InChI=1S/C25H30N2O3/c1-4-6-10-18(5-2)22-21-23(30-27(22)20-11-8-7-9-12-20)25(29)26(24(21)28)19-15-13-17(3)14-16-19/h7-9,11-16,18,21-23H,4-6,10H2,1-3H3/t18-,21-,22+,23+/m1/s1 |
| InChIKey | NJBXYNKCLWDUAR-QQUTXWOLSA-N |
| XLogP | 4.89 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|