About 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile
5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile (PubChem CID 74996624) has the molecular formula C11H12N4O2
and a molecular weight of 232.24 g/mol. Its IUPAC name is 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile |
| PubChem CID | 74996624 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile |
| SMILES | N#Cc1cc(CON=C2CN3CCC2C3)on1 |
| InChI | InChI=1S/C11H12N4O2/c12-4-9-3-10(17-13-9)7-16-14-11-6-15-2-1-8(11)5-15/h3,8H,1-2,5-7H2 |
| InChIKey | FLETZUNPOBFSJC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 74.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile?
The IUPAC name of 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile (CID 74996624) is 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile.
What is the SMILES notation for 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile?
The canonical SMILES for 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile is N#Cc1cc(CON=C2CN3CCC2C3)on1.
What is the InChIKey of 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile?
The InChIKey is FLETZUNPOBFSJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O2/c12-4-9-3-10(17-13-9)7-16-14-11-6-15-2-1-8(11)5-15/h3,8H,1-2,5-7H2.
What are the key properties of 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile?
5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile has a molecular weight of 232.24 g/mol, XLogP of 0.75, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1-azabicyclo[2.2.1]heptan-3-ylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile is sourced from PubChem (CID 74996624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).