About 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile
5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile (PubChem CID 74996667) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile |
| PubChem CID | 74996667 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile |
| SMILES | N#Cc1cc(CON=CC2CN3CCC2CC3)on1 |
| InChI | InChI=1S/C13H16N4O2/c14-6-12-5-13(19-16-12)9-18-15-7-11-8-17-3-1-10(11)2-4-17/h5,7,10-11H,1-4,8-9H2 |
| InChIKey | MPBOWNWMDFRKKV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile?
The IUPAC name of 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile (CID 74996667) is 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile.
What is the SMILES notation for 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile?
The canonical SMILES for 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile is N#Cc1cc(CON=CC2CN3CCC2CC3)on1.
What is the InChIKey of 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile?
The InChIKey is MPBOWNWMDFRKKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2/c14-6-12-5-13(19-16-12)9-18-15-7-11-8-17-3-1-10(11)2-4-17/h5,7,10-11H,1-4,8-9H2.
What are the key properties of 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile?
5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile has a molecular weight of 260.30 g/mol, XLogP of 1.39, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1-azabicyclo[2.2.2]octan-3-ylmethylideneamino)oxymethyl]-1,2-oxazole-3-carbonitrile is sourced from PubChem (CID 74996667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).