C12H20N2O2 — CID 74997575
5-(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl)pentanimidamide (PubChem CID 74997575) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 5-(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl)pentanimidamide.
| Compound Name | 5-(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl)pentanimidamide |
|---|---|
| PubChem CID | 74997575 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 5-(2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-yl)pentanimidamide |
| SMILES | [H]/N=C(\N)CCCCC1C(=O)OC2CCCC21 |
| InChI | InChI=1S/C12H20N2O2/c13-11(14)7-2-1-4-9-8-5-3-6-10(8)16-12(9)15/h8-10H,1-7H2,(H3,13,14) |
| InChIKey | LLZNZOUKCHIYKS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|