About 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine
1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine (PubChem CID 74998952) has the molecular formula C17H23N6+
and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine.
Molecular Properties
| Compound Name | 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine |
| PubChem CID | 74998952 |
| Molecular Formula | C17H23N6+ |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine |
| SMILES | CC/N=C(\N)NN=Cc1ccc(C=Cc2n(C)cc[n+]2C)cc1 |
| InChI | InChI=1S/C17H22N6/c1-4-19-17(18)21-20-13-15-7-5-14(6-8-15)9-10-16-22(2)11-12-23(16)3/h5-13H,4H2,1-3H3,(H2,18,19)/p+1 |
| InChIKey | RXSAOJNCEJIIQP-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine?
The IUPAC name of 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine (CID 74998952) is 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine.
What is the SMILES notation for 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine?
The canonical SMILES for 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine is CC/N=C(\N)NN=Cc1ccc(C=Cc2n(C)cc[n+]2C)cc1.
What is the InChIKey of 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine?
The InChIKey is RXSAOJNCEJIIQP-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H22N6/c1-4-19-17(18)21-20-13-15-7-5-14(6-8-15)9-10-16-22(2)11-12-23(16)3/h5-13H,4H2,1-3H3,(H2,18,19)/p+1.
What are the key properties of 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine?
1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine has a molecular weight of 311.41 g/mol, XLogP of 1.28, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-[2-(1,3-dimethylimidazol-1-ium-2-yl)ethenyl]phenyl]methylideneamino]-2-ethylguanidine is sourced from PubChem (CID 74998952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).