C19H15Cl2NO5S — CID 75003786
5-[[4-[3-(3,4-dichlorophenoxy)-2-hydroxypropoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 75003786) has the molecular formula C19H15Cl2NO5S and a molecular weight of 440.30 g/mol. Its IUPAC name is 5-[[4-[3-(3,4-dichlorophenoxy)-2-hydroxypropoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[3-(3,4-dichlorophenoxy)-2-hydroxypropoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 75003786 |
| Molecular Formula | C19H15Cl2NO5S |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 439.00 |
| IUPAC Name | 5-[[4-[3-(3,4-dichlorophenoxy)-2-hydroxypropoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(OCC(O)COc3ccc(Cl)c(Cl)c3)cc2)S1 |
| InChI | InChI=1S/C19H15Cl2NO5S/c20-15-6-5-14(8-16(15)21)27-10-12(23)9-26-13-3-1-11(2-4-13)7-17-18(24)22-19(25)28-17/h1-8,12,23H,9-10H2,(H,22,24,25) |
| InChIKey | KHHRJPJRTMSQDR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|