About 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile
4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile (PubChem CID 75004286) has the molecular formula C27H26N4O
and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile.
Molecular Properties
| Compound Name | 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile |
| PubChem CID | 75004286 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile |
| SMILES | CCCC=CC=Cc1cc(C#N)ccc1COC(c1ccc(C#N)cc1)c1cncn1C |
| InChI | InChI=1S/C27H26N4O/c1-3-4-5-6-7-8-24-15-22(17-29)11-14-25(24)19-32-27(26-18-30-20-31(26)2)23-12-9-21(16-28)10-13-23/h5-15,18,20,27H,3-4,19H2,1-2H3 |
| InChIKey | ZEIRRWOZIKZYIO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 74.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile?
The IUPAC name of 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile (CID 75004286) is 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile.
What is the SMILES notation for 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile?
The canonical SMILES for 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile is CCCC=CC=Cc1cc(C#N)ccc1COC(c1ccc(C#N)cc1)c1cncn1C.
What is the InChIKey of 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile?
The InChIKey is ZEIRRWOZIKZYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N4O/c1-3-4-5-6-7-8-24-15-22(17-29)11-14-25(24)19-32-27(26-18-30-20-31(26)2)23-12-9-21(16-28)10-13-23/h5-15,18,20,27H,3-4,19H2,1-2H3.
What are the key properties of 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile?
4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile has a molecular weight of 422.53 g/mol, XLogP of 5.84, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(4-cyanophenyl)-(3-methylimidazol-4-yl)methoxy]methyl]-3-hepta-1,3-dienylbenzonitrile is sourced from PubChem (CID 75004286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).