C23H25N2O4- — CID 7500697
(2R,3R)-3-methyl-2-[[(E)-2-[(4-methylbenzoyl)amino]-3-phenylprop-2-enoyl]amino]pentanoate (PubChem CID 7500697) has the molecular formula C23H25N2O4- and a molecular weight of 393.46 g/mol. Its IUPAC name is (2R,3R)-3-methyl-2-[[(E)-2-[(4-methylbenzoyl)amino]-3-phenylprop-2-enoyl]amino]pentanoate.
| Compound Name | (2R,3R)-3-methyl-2-[[(E)-2-[(4-methylbenzoyl)amino]-3-phenylprop-2-enoyl]amino]pentanoate |
|---|---|
| PubChem CID | 7500697 |
| Molecular Formula | C23H25N2O4- |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (2R,3R)-3-methyl-2-[[(E)-2-[(4-methylbenzoyl)amino]-3-phenylprop-2-enoyl]amino]pentanoate |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)/C(=C\c1ccccc1)NC(=O)c1ccc(C)cc1)C(=O)[O-] |
| InChI | InChI=1S/C23H26N2O4/c1-4-16(3)20(23(28)29)25-22(27)19(14-17-8-6-5-7-9-17)24-21(26)18-12-10-15(2)11-13-18/h5-14,16,20H,4H2,1-3H3,(H,24,26)(H,25,27)(H,28,29)/p-1/b19-14+/t16-,20-/m1/s1 |
| InChIKey | AQDQXSSXSIVYML-OEVWGLMUSA-M |
| XLogP | 2.05 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|