C11H15F6NO2 — CID 750114
[(1R,2R)-2-methylcyclohexyl] N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate (PubChem CID 750114) has the molecular formula C11H15F6NO2 and a molecular weight of 307.23 g/mol. Its IUPAC name is [(1R,2R)-2-methylcyclohexyl] N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate.
| Compound Name | [(1R,2R)-2-methylcyclohexyl] N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate |
|---|---|
| PubChem CID | 750114 |
| Molecular Formula | C11H15F6NO2 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | [(1R,2R)-2-methylcyclohexyl] N-(1,1,1,3,3,3-hexafluoropropan-2-yl)carbamate |
| SMILES | C[C@@H]1CCCC[C@H]1OC(=O)NC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H15F6NO2/c1-6-4-2-3-5-7(6)20-9(19)18-8(10(12,13)14)11(15,16)17/h6-8H,2-5H2,1H3,(H,18,19)/t6-,7-/m1/s1 |
| InChIKey | VRHUGIBBUSYLNG-RNFRBKRXSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |