C19H16FN3O2S — CID 7501356
3-(2-fluorophenyl)-2-(2-methoxyethylsulfanyl)-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 7501356) has the molecular formula C19H16FN3O2S and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-2-(2-methoxyethylsulfanyl)-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-(2-fluorophenyl)-2-(2-methoxyethylsulfanyl)-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 7501356 |
| Molecular Formula | C19H16FN3O2S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 3-(2-fluorophenyl)-2-(2-methoxyethylsulfanyl)-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | COCCSc1nc2c([nH]c3ccccc32)c(=O)n1-c1ccccc1F |
| InChI | InChI=1S/C19H16FN3O2S/c1-25-10-11-26-19-22-16-12-6-2-4-8-14(12)21-17(16)18(24)23(19)15-9-5-3-7-13(15)20/h2-9,21H,10-11H2,1H3 |
| InChIKey | HBEXBLJFWLNHSI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|